C12H11Br3O2 — CID 101293396
2-prop-2-enyl-3-[(2,3,4-tribromophenoxy)methyl]oxirane (PubChem CID 101293396) has the molecular formula C12H11Br3O2 and a molecular weight of 426.93 g/mol. Its IUPAC name is 2-prop-2-enyl-3-[(2,3,4-tribromophenoxy)methyl]oxirane.
| Compound Name | 2-prop-2-enyl-3-[(2,3,4-tribromophenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 101293396 |
| Molecular Formula | C12H11Br3O2 |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 423.83 |
| IUPAC Name | 2-prop-2-enyl-3-[(2,3,4-tribromophenoxy)methyl]oxirane |
| SMILES | C=CCC1OC1COc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C12H11Br3O2/c1-2-3-8-10(17-8)6-16-9-5-4-7(13)11(14)12(9)15/h2,4-5,8,10H,1,3,6H2 |
| InChIKey | GNIICBFGPHNRLR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|