C7H6NNaO6S — CID 101305634
sodium 3-amino-2-carboxy-5-sulfophenolate (PubChem CID 101305634) has the molecular formula C7H6NNaO6S and a molecular weight of 255.18 g/mol. Its IUPAC name is sodium 3-amino-2-carboxy-5-sulfophenolate.
| Compound Name | sodium 3-amino-2-carboxy-5-sulfophenolate |
|---|---|
| PubChem CID | 101305634 |
| Molecular Formula | C7H6NNaO6S |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | sodium 3-amino-2-carboxy-5-sulfophenolate |
| SMILES | Nc1cc(S(=O)(=O)O)cc([O-])c1C(=O)O.[Na+] |
| InChI | InChI=1S/C7H7NO6S.Na/c8-4-1-3(15(12,13)14)2-5(9)6(4)7(10)11;/h1-2,9H,8H2,(H,10,11)(H,12,13,14);/q;+1/p-1 |
| InChIKey | FWIQMRFRUQXOKG-UHFFFAOYSA-M |
| XLogP | -3.71 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|