C7H5NNa2O6S — CID 101305670
disodium;2-amino-6-oxido-4-sulfobenzoate (PubChem CID 101305670) has the molecular formula C7H5NNa2O6S and a molecular weight of 277.17 g/mol. Its IUPAC name is disodium;2-amino-6-oxido-4-sulfobenzoate.
| Compound Name | disodium;2-amino-6-oxido-4-sulfobenzoate |
|---|---|
| PubChem CID | 101305670 |
| Molecular Formula | C7H5NNa2O6S |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | disodium;2-amino-6-oxido-4-sulfobenzoate |
| SMILES | Nc1cc(S(=O)(=O)O)cc([O-])c1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H7NO6S.2Na/c8-4-1-3(15(12,13)14)2-5(9)6(4)7(10)11;;/h1-2,9H,8H2,(H,10,11)(H,12,13,14);;/q;2*+1/p-2 |
| InChIKey | YLMNOVBMOPDPOF-UHFFFAOYSA-L |
| XLogP | -8.04 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | -8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|