C24H34O7S — CID 101307902
2,3-bis[[(E)-oct-1-enoxy]carbonyl]benzenesulfonic acid (PubChem CID 101307902) has the molecular formula C24H34O7S and a molecular weight of 466.60 g/mol. Its IUPAC name is 2,3-bis[[(E)-oct-1-enoxy]carbonyl]benzenesulfonic acid.
| Compound Name | 2,3-bis[[(E)-oct-1-enoxy]carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 101307902 |
| Molecular Formula | C24H34O7S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2,3-bis[[(E)-oct-1-enoxy]carbonyl]benzenesulfonic acid |
| SMILES | CCCCCC/C=C/OC(=O)c1cccc(S(=O)(=O)O)c1C(=O)O/C=C/CCCCCC |
| InChI | InChI=1S/C24H34O7S/c1-3-5-7-9-11-13-18-30-23(25)20-16-15-17-21(32(27,28)29)22(20)24(26)31-19-14-12-10-8-6-4-2/h13-19H,3-12H2,1-2H3,(H,27,28,29)/b18-13+,19-14+ |
| InChIKey | PWXLQMCIPNVWBU-JIBZRZDWSA-N |
| XLogP | 6.22 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|