C38H61KO7S — CID 101308534
potassium 3,4-bis[[(E)-pentadec-4-enoxy]carbonyl]benzenesulfonate (PubChem CID 101308534) has the molecular formula C38H61KO7S and a molecular weight of 701.06 g/mol. Its IUPAC name is potassium 3,4-bis[[(E)-pentadec-4-enoxy]carbonyl]benzenesulfonate.
| Compound Name | potassium 3,4-bis[[(E)-pentadec-4-enoxy]carbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 101308534 |
| Molecular Formula | C38H61KO7S |
| Molecular Weight | 701.06 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | potassium 3,4-bis[[(E)-pentadec-4-enoxy]carbonyl]benzenesulfonate |
| SMILES | CCCCCCCCCC/C=C/CCCOC(=O)c1ccc(S(=O)(=O)[O-])cc1C(=O)OCCC/C=C/CCCCCCCCCC.[K+] |
| InChI | InChI=1S/C38H62O7S.K/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-44-37(39)35-30-29-34(46(41,42)43)33-36(35)38(40)45-32-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h21-24,29-30,33H,3-20,25-28,31-32H2,1-2H3,(H,41,42,43);/q;+1/p-1/b23-21+,24-22+; |
| InChIKey | GMZIBIPJFIXSQU-BAYNMDCWSA-M |
| XLogP | 7.64 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.06 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|