C18H16N4OS — CID 10131857
4-(3-but-2-ynylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine (PubChem CID 10131857) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-(3-but-2-ynylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4-(3-but-2-ynylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 10131857 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-(3-but-2-ynylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine |
| SMILES | CC#CCSc1noc(C)c1-c1ccnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H16N4OS/c1-3-4-12-24-17-16(13(2)23-22-17)15-10-11-19-18(21-15)20-14-8-6-5-7-9-14/h5-11H,12H2,1-2H3,(H,19,20,21) |
| InChIKey | CLSLDQAPRFAXNG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|