C15H14N4O — CID 117088076
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-4-amine (PubChem CID 117088076) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-4-amine.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 117088076 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-4-amine |
| SMILES | Cc1noc(C)c1-c1nccc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H14N4O/c1-10-14(11(2)20-19-10)15-16-9-8-13(18-15)17-12-6-4-3-5-7-12/h3-9H,1-2H3,(H,16,17,18) |
| InChIKey | OKFLPEHEITWURH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |