C21H17N3O — CID 20622538
6-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-N-phenylpyridin-2-amine (PubChem CID 20622538) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 6-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-N-phenylpyridin-2-amine.
| Compound Name | 6-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 20622538 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 6-(3-methyl-5-phenyl-1,2-oxazol-4-yl)-N-phenylpyridin-2-amine |
| SMILES | Cc1noc(-c2ccccc2)c1-c1cccc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C21H17N3O/c1-15-20(21(25-24-15)16-9-4-2-5-10-16)18-13-8-14-19(23-18)22-17-11-6-3-7-12-17/h2-14H,1H3,(H,22,23) |
| InChIKey | ZKUCLBUGOPASEX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |