C21H22N2 — CID 102591191
N,6-bis(2,6-dimethylphenyl)pyridin-2-amine (PubChem CID 102591191) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N,6-bis(2,6-dimethylphenyl)pyridin-2-amine.
| Compound Name | N,6-bis(2,6-dimethylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102591191 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N,6-bis(2,6-dimethylphenyl)pyridin-2-amine |
| SMILES | Cc1cccc(C)c1Nc1cccc(-c2c(C)cccc2C)n1 |
| InChI | InChI=1S/C21H22N2/c1-14-8-5-9-15(2)20(14)18-12-7-13-19(22-18)23-21-16(3)10-6-11-17(21)4/h5-13H,1-4H3,(H,22,23) |
| InChIKey | ZSELLDRIRLCYSN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |