C22H26N4 — CID 135191670
2-N,6-N-bis(2,6-dimethylphenyl)-4-methylpyridine-2,3,6-triamine (PubChem CID 135191670) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-N,6-N-bis(2,6-dimethylphenyl)-4-methylpyridine-2,3,6-triamine.
| Compound Name | 2-N,6-N-bis(2,6-dimethylphenyl)-4-methylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 135191670 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-N,6-N-bis(2,6-dimethylphenyl)-4-methylpyridine-2,3,6-triamine |
| SMILES | Cc1cc(Nc2c(C)cccc2C)nc(Nc2c(C)cccc2C)c1N |
| InChI | InChI=1S/C22H26N4/c1-13-8-6-9-14(2)20(13)24-18-12-17(5)19(23)22(25-18)26-21-15(3)10-7-11-16(21)4/h6-12H,23H2,1-5H3,(H2,24,25,26) |
| InChIKey | ZVJRBKGRDIHNNQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |