C21H26N4OS — CID 10177970
4-(3-heptylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine (PubChem CID 10177970) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-(3-heptylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4-(3-heptylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 10177970 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-(3-heptylsulfanyl-5-methyl-1,2-oxazol-4-yl)-N-phenylpyrimidin-2-amine |
| SMILES | CCCCCCCSc1noc(C)c1-c1ccnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C21H26N4OS/c1-3-4-5-6-10-15-27-20-19(16(2)26-25-20)18-13-14-22-21(24-18)23-17-11-8-7-9-12-17/h7-9,11-14H,3-6,10,15H2,1-2H3,(H,22,23,24) |
| InChIKey | PVTLEEWCZJYGEA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|