C18H21N5 — CID 69314565
4-(2-butyl-3-methylimidazol-4-yl)-N-phenylpyrimidin-2-amine (PubChem CID 69314565) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-(2-butyl-3-methylimidazol-4-yl)-N-phenylpyrimidin-2-amine.
| Compound Name | 4-(2-butyl-3-methylimidazol-4-yl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 69314565 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-(2-butyl-3-methylimidazol-4-yl)-N-phenylpyrimidin-2-amine |
| SMILES | CCCCc1ncc(-c2ccnc(Nc3ccccc3)n2)n1C |
| InChI | InChI=1S/C18H21N5/c1-3-4-10-17-20-13-16(23(17)2)15-11-12-19-18(22-15)21-14-8-6-5-7-9-14/h5-9,11-13H,3-4,10H2,1-2H3,(H,19,21,22) |
| InChIKey | IGGCHNZPPVTCLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |