C19H24N6O4S — CID 69314380
N-(2-methoxyethyl)-4-[[4-[2-(methoxymethyl)-3-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 69314380) has the molecular formula C19H24N6O4S and a molecular weight of 432.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[4-[2-(methoxymethyl)-3-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-4-[[4-[2-(methoxymethyl)-3-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 69314380 |
| Molecular Formula | C19H24N6O4S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[4-[2-(methoxymethyl)-3-methylimidazol-4-yl]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Nc2nccc(-c3cnc(COC)n3C)n2)cc1 |
| InChI | InChI=1S/C19H24N6O4S/c1-25-17(12-21-18(25)13-29-3)16-8-9-20-19(24-16)23-14-4-6-15(7-5-14)30(26,27)22-10-11-28-2/h4-9,12,22H,10-11,13H2,1-3H3,(H,20,23,24) |
| InChIKey | URVXFLYFLFKCTH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|