C19H19N7O3S — CID 170987320
4-[(4-imidazo[1,2-a]pyrimidin-3-ylpyrimidin-2-yl)amino]-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 170987320) has the molecular formula C19H19N7O3S and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-[(4-imidazo[1,2-a]pyrimidin-3-ylpyrimidin-2-yl)amino]-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-[(4-imidazo[1,2-a]pyrimidin-3-ylpyrimidin-2-yl)amino]-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 170987320 |
| Molecular Formula | C19H19N7O3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-[(4-imidazo[1,2-a]pyrimidin-3-ylpyrimidin-2-yl)amino]-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Nc2nccc(-c3cnc4ncccn34)n2)cc1 |
| InChI | InChI=1S/C19H19N7O3S/c1-29-12-10-23-30(27,28)15-5-3-14(4-6-15)24-18-20-9-7-16(25-18)17-13-22-19-21-8-2-11-26(17)19/h2-9,11,13,23H,10,12H2,1H3,(H,20,24,25) |
| InChIKey | PIXKDECCRNPWOQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|