C20H24N6O4S — CID 87890834
N-(2-methoxyethyl)-4-[[4-[2-(2-methyl-1-oxopropan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 87890834) has the molecular formula C20H24N6O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[4-[2-(2-methyl-1-oxopropan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-4-[[4-[2-(2-methyl-1-oxopropan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 87890834 |
| Molecular Formula | C20H24N6O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[4-[2-(2-methyl-1-oxopropan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Nc2nccc(-c3cnc(C(C)(C)C=O)[nH]3)n2)cc1 |
| InChI | InChI=1S/C20H24N6O4S/c1-20(2,13-27)18-22-12-17(25-18)16-8-9-21-19(26-16)24-14-4-6-15(7-5-14)31(28,29)23-10-11-30-3/h4-9,12-13,23H,10-11H2,1-3H3,(H,22,25)(H,21,24,26) |
| InChIKey | YIJIBCYBESXBIH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|