C18H18N6 — CID 91103828
ethane;N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine (PubChem CID 91103828) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is ethane;N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine.
| Compound Name | ethane;N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 91103828 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethane;N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
| SMILES | CC.c1ccc(Nc2nccc(-c3cnn4ncccc34)n2)cc1 |
| InChI | InChI=1S/C16H12N6.C2H6/c1-2-5-12(6-3-1)20-16-17-10-8-14(21-16)13-11-19-22-15(13)7-4-9-18-22;1-2/h1-11H,(H,17,20,21);1-2H3 |
| InChIKey | QJHKEOWCCKTGEJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |