C17H23NO6 — CID 101318888
2-(N-acetyl-3-acetyloxy-5-methoxy-2,4-dimethylanilino)ethyl acetate (PubChem CID 101318888) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-(N-acetyl-3-acetyloxy-5-methoxy-2,4-dimethylanilino)ethyl acetate.
| Compound Name | 2-(N-acetyl-3-acetyloxy-5-methoxy-2,4-dimethylanilino)ethyl acetate |
|---|---|
| PubChem CID | 101318888 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(N-acetyl-3-acetyloxy-5-methoxy-2,4-dimethylanilino)ethyl acetate |
| SMILES | COc1cc(N(CCOC(C)=O)C(C)=O)c(C)c(OC(C)=O)c1C |
| InChI | InChI=1S/C17H23NO6/c1-10-15(18(12(3)19)7-8-23-13(4)20)9-16(22-6)11(2)17(10)24-14(5)21/h9H,7-8H2,1-6H3 |
| InChIKey | KZQSYDCXRAAFPA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|