C15H18O7 — CID 10662709
[2-(2-acetyloxy-4,6-dimethoxy-3-methylphenyl)-2-oxoethyl] acetate (PubChem CID 10662709) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is [2-(2-acetyloxy-4,6-dimethoxy-3-methylphenyl)-2-oxoethyl] acetate.
| Compound Name | [2-(2-acetyloxy-4,6-dimethoxy-3-methylphenyl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 10662709 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [2-(2-acetyloxy-4,6-dimethoxy-3-methylphenyl)-2-oxoethyl] acetate |
| SMILES | COc1cc(OC)c(C(=O)COC(C)=O)c(OC(C)=O)c1C |
| InChI | InChI=1S/C15H18O7/c1-8-12(19-4)6-13(20-5)14(15(8)22-10(3)17)11(18)7-21-9(2)16/h6H,7H2,1-5H3 |
| InChIKey | YOFOZJHBXTZKKE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|