C16H31N3 — CID 101322978
1-[2-[(E)-undec-2-enyl]-2,4-dihydroimidazol-3-yl]ethanamine (PubChem CID 101322978) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-[2-[(E)-undec-2-enyl]-2,4-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-undec-2-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101322978 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 1-[2-[(E)-undec-2-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCCCCC/C=C/CC1N=CCN1C(C)N |
| InChI | InChI=1S/C16H31N3/c1-3-4-5-6-7-8-9-10-11-12-16-18-13-14-19(16)15(2)17/h10-11,13,15-16H,3-9,12,14,17H2,1-2H3/b11-10+ |
| InChIKey | XLRSKBPFWHUNIC-ZHACJKMWSA-N |
| XLogP | 3.70 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|