C20H39N3 — CID 101323314
1-[2-[(E)-pentadec-4-enyl]-2,4-dihydroimidazol-3-yl]ethanamine (PubChem CID 101323314) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 1-[2-[(E)-pentadec-4-enyl]-2,4-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-pentadec-4-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101323314 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 1-[2-[(E)-pentadec-4-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCCCCCCC/C=C/CCCC1N=CCN1C(C)N |
| InChI | InChI=1S/C20H39N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-22-17-18-23(20)19(2)21/h12-13,17,19-20H,3-11,14-16,18,21H2,1-2H3/b13-12+ |
| InChIKey | CRHAUUUQYVFSAI-OUKQBFOZSA-N |
| XLogP | 5.26 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|