C21H41N3 — CID 101323407
1-[2-[(E)-hexadec-12-enyl]-2,4-dihydroimidazol-3-yl]ethanamine (PubChem CID 101323407) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 1-[2-[(E)-hexadec-12-enyl]-2,4-dihydroimidazol-3-yl]ethanamine.
| Compound Name | 1-[2-[(E)-hexadec-12-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 101323407 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 1-[2-[(E)-hexadec-12-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCC/C=C/CCCCCCCCCCCC1N=CCN1C(C)N |
| InChI | InChI=1S/C21H41N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-23-18-19-24(21)20(2)22/h5-6,18,20-21H,3-4,7-17,19,22H2,1-2H3/b6-5+ |
| InChIKey | SQQUDPABFUODMI-AATRIKPKSA-N |
| XLogP | 5.65 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|