C30H50O — CID 101323711
(1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(1R)-1-[2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]pentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol (PubChem CID 101323711) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(1R)-1-[2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]pentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol.
| Compound Name | (1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(1R)-1-[2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]pentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
|---|---|
| PubChem CID | 101323711 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (1S,2R,5S,7S,9R,11S,12S,15R,16R)-2,16-dimethyl-15-[(1R)-1-[2-[(2R)-3-methylbutan-2-yl]cyclopropyl]ethyl]pentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
| SMILES | CC(C)[C@@H](C)C1CC1[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H]4C[C@]45C[C@@H](O)CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H50O/c1-17(2)18(3)22-14-23(22)19(4)25-7-8-26-24-13-20-15-30(20)16-21(31)9-12-29(30,6)27(24)10-11-28(25,26)5/h17-27,31H,7-16H2,1-6H3/t18-,19-,20-,21+,22?,23?,24+,25-,26+,27+,28-,29-,30+/m1/s1 |
| InChIKey | KBIISECRRPIFNU-ZRECPQCJSA-N |
| XLogP | 7.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |