C22H40N3O2+ — CID 101325739
2-[1-(1-aminoethyl)-2-[(E)-pentadec-4-enyl]imidazol-1-ium-1-yl]acetic acid (PubChem CID 101325739) has the molecular formula C22H40N3O2+ and a molecular weight of 378.58 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)-2-[(E)-pentadec-4-enyl]imidazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-(1-aminoethyl)-2-[(E)-pentadec-4-enyl]imidazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 101325739 |
| Molecular Formula | C22H40N3O2+ |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-[1-(1-aminoethyl)-2-[(E)-pentadec-4-enyl]imidazol-1-ium-1-yl]acetic acid |
| SMILES | CCCCCCCCCC/C=C/CCCC1=NC=C[N+]1(CC(=O)O)C(C)N |
| InChI | InChI=1S/C22H39N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-24-17-18-25(21,20(2)23)19-22(26)27/h12-13,17-18,20H,3-11,14-16,19,23H2,1-2H3/p+1/b13-12+ |
| InChIKey | NVHXJAXGCNCOOH-OUKQBFOZSA-O |
| XLogP | 5.33 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|