C23H42N3O2+ — CID 101325768
2-[1-(1-aminoethyl)-2-[(E)-hexadec-5-enyl]imidazol-1-ium-1-yl]acetic acid (PubChem CID 101325768) has the molecular formula C23H42N3O2+ and a molecular weight of 392.61 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)-2-[(E)-hexadec-5-enyl]imidazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-(1-aminoethyl)-2-[(E)-hexadec-5-enyl]imidazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 101325768 |
| Molecular Formula | C23H42N3O2+ |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 2-[1-(1-aminoethyl)-2-[(E)-hexadec-5-enyl]imidazol-1-ium-1-yl]acetic acid |
| SMILES | CCCCCCCCCC/C=C/CCCCC1=NC=C[N+]1(CC(=O)O)C(C)N |
| InChI | InChI=1S/C23H41N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-25-18-19-26(22,21(2)24)20-23(27)28/h12-13,18-19,21H,3-11,14-17,20,24H2,1-2H3/p+1/b13-12+ |
| InChIKey | DTARXBFHJBLZEN-OUKQBFOZSA-O |
| XLogP | 5.72 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|