C27H50N3O2+ — CID 101325905
2-[1-(1-aminoethyl)-2-[(E)-icos-10-enyl]imidazol-1-ium-1-yl]acetic acid (PubChem CID 101325905) has the molecular formula C27H50N3O2+ and a molecular weight of 448.72 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)-2-[(E)-icos-10-enyl]imidazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-(1-aminoethyl)-2-[(E)-icos-10-enyl]imidazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 101325905 |
| Molecular Formula | C27H50N3O2+ |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | 2-[1-(1-aminoethyl)-2-[(E)-icos-10-enyl]imidazol-1-ium-1-yl]acetic acid |
| SMILES | CCCCCCCCC/C=C/CCCCCCCCCC1=NC=C[N+]1(CC(=O)O)C(C)N |
| InChI | InChI=1S/C27H49N3O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-29-22-23-30(26,25(2)28)24-27(31)32/h11-12,22-23,25H,3-10,13-21,24,28H2,1-2H3/p+1/b12-11+ |
| InChIKey | RVEAQUSLDASKDI-VAWYXSNFSA-O |
| XLogP | 7.28 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|