C13H24N2O — CID 101327458
2-[2-[(E)-oct-4-enyl]-4,5-dihydroimidazol-1-yl]ethanol (PubChem CID 101327458) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-[2-[(E)-oct-4-enyl]-4,5-dihydroimidazol-1-yl]ethanol.
| Compound Name | 2-[2-[(E)-oct-4-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 101327458 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-[2-[(E)-oct-4-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
| SMILES | CCC/C=C/CCCC1=NCCN1CCO |
| InChI | InChI=1S/C13H24N2O/c1-2-3-4-5-6-7-8-13-14-9-10-15(13)11-12-16/h4-5,16H,2-3,6-12H2,1H3/b5-4+ |
| InChIKey | ZXERRMWJVUIMBN-SNAWJCMRSA-N |
| XLogP | 2.22 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|