C14H26N2O — CID 101327478
2-[2-[(E)-non-3-enyl]-4,5-dihydroimidazol-1-yl]ethanol (PubChem CID 101327478) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[2-[(E)-non-3-enyl]-4,5-dihydroimidazol-1-yl]ethanol.
| Compound Name | 2-[2-[(E)-non-3-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 101327478 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-[2-[(E)-non-3-enyl]-4,5-dihydroimidazol-1-yl]ethanol |
| SMILES | CCCCC/C=C/CCC1=NCCN1CCO |
| InChI | InChI=1S/C14H26N2O/c1-2-3-4-5-6-7-8-9-14-15-10-11-16(14)12-13-17/h6-7,17H,2-5,8-13H2,1H3/b7-6+ |
| InChIKey | FSOZSVFQHSNSAM-VOTSOKGWSA-N |
| XLogP | 2.61 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|