C9H6N3O2+ — CID 101332982
2-methyl-1,3-dioxoisoindole-5-diazonium (PubChem CID 101332982) has the molecular formula C9H6N3O2+ and a molecular weight of 188.17 g/mol. Its IUPAC name is 2-methyl-1,3-dioxoisoindole-5-diazonium.
| Compound Name | 2-methyl-1,3-dioxoisoindole-5-diazonium |
|---|---|
| PubChem CID | 101332982 |
| Molecular Formula | C9H6N3O2+ |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-methyl-1,3-dioxoisoindole-5-diazonium |
| SMILES | CN1C(=O)c2ccc([N+]#N)cc2C1=O |
| InChI | InChI=1S/C9H6N3O2/c1-12-8(13)6-3-2-5(11-10)4-7(6)9(12)14/h2-4H,1H3/q+1 |
| InChIKey | BOHBOGQBSOADRQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|