C9H6ClNO2S — CID 163466743
(2-methyl-1,3-dioxoisoindol-5-yl) thiohypochlorite (PubChem CID 163466743) has the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. Its IUPAC name is (2-methyl-1,3-dioxoisoindol-5-yl) thiohypochlorite.
| Compound Name | (2-methyl-1,3-dioxoisoindol-5-yl) thiohypochlorite |
|---|---|
| PubChem CID | 163466743 |
| Molecular Formula | C9H6ClNO2S |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | (2-methyl-1,3-dioxoisoindol-5-yl) thiohypochlorite |
| SMILES | CN1C(=O)c2ccc(SCl)cc2C1=O |
| InChI | InChI=1S/C9H6ClNO2S/c1-11-8(12)6-3-2-5(14-10)4-7(6)9(11)13/h2-4H,1H3 |
| InChIKey | BTGDFTSNKGJMPB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|