C25H30N2O4 — CID 143852340
ethane;2-methyl-5-[2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindole-1,3-dione (PubChem CID 143852340) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethane;2-methyl-5-[2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindole-1,3-dione.
| Compound Name | ethane;2-methyl-5-[2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143852340 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | ethane;2-methyl-5-[2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindole-1,3-dione |
| SMILES | CC.CC.CN1C(=O)c2ccc(C(C)(C)c3ccc4c(c3)C(=O)N(C)C4=O)cc2C1=O |
| InChI | InChI=1S/C21H18N2O4.2C2H6/c1-21(2,11-5-7-13-15(9-11)19(26)22(3)17(13)24)12-6-8-14-16(10-12)20(27)23(4)18(14)25;2*1-2/h5-10H,1-4H3;2*1-2H3 |
| InChIKey | PCORQOGJSLSWSA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|