C19H40O3Si2 — CID 101333015
4-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyheptyl]-3-trimethylsilyloxetan-2-one (PubChem CID 101333015) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is 4-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyheptyl]-3-trimethylsilyloxetan-2-one.
| Compound Name | 4-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyheptyl]-3-trimethylsilyloxetan-2-one |
|---|---|
| PubChem CID | 101333015 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 4-[(2R)-2-[tert-butyl(dimethyl)silyl]oxyheptyl]-3-trimethylsilyloxetan-2-one |
| SMILES | CCCCC[C@H](CC1OC(=O)C1[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-10-11-12-13-15(22-24(8,9)19(2,3)4)14-16-17(18(20)21-16)23(5,6)7/h15-17H,10-14H2,1-9H3/t15-,16?,17?/m1/s1 |
| InChIKey | GJJRKIXPMAMKBX-KLAILNCOSA-N |
| XLogP | 5.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|