C46H50O12 — CID 101334589
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3S)-1-methoxy-1-oxoundecan-3-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 101334589) has the molecular formula C46H50O12 and a molecular weight of 794.89 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3S)-1-methoxy-1-oxoundecan-3-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3S)-1-methoxy-1-oxoundecan-3-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101334589 |
| Molecular Formula | C46H50O12 |
| Molecular Weight | 794.89 g/mol |
| Exact Mass | 794.33 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(3S)-1-methoxy-1-oxoundecan-3-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCCCCC[C@@H](CC(=O)OC)O[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C46H50O12/c1-3-4-5-6-7-20-29-36(30-38(47)52-2)54-46-41(58-45(51)35-27-18-11-19-28-35)40(57-44(50)34-25-16-10-17-26-34)39(56-43(49)33-23-14-9-15-24-33)37(55-46)31-53-42(48)32-21-12-8-13-22-32/h8-19,21-28,36-37,39-41,46H,3-7,20,29-31H2,1-2H3/t36-,37+,39+,40-,41+,46+/m0/s1 |
| InChIKey | YYODNWBNEBLGPR-BMZWMESWSA-N |
| XLogP | 7.94 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.89 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|