C40H38O10 — CID 166508451
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(2R)-hex-5-en-2-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 166508451) has the molecular formula C40H38O10 and a molecular weight of 678.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(2R)-hex-5-en-2-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(2R)-hex-5-en-2-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 166508451 |
| Molecular Formula | C40H38O10 |
| Molecular Weight | 678.73 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(2R)-hex-5-en-2-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | C=CCC[C@@H](C)O[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H38O10/c1-3-4-17-27(2)46-40-35(50-39(44)31-24-15-8-16-25-31)34(49-38(43)30-22-13-7-14-23-30)33(48-37(42)29-20-11-6-12-21-29)32(47-40)26-45-36(41)28-18-9-5-10-19-28/h3,5-16,18-25,27,32-35,40H,1,4,17,26H2,2H3/t27-,32-,33-,34+,35-,40-/m1/s1 |
| InChIKey | BMRWMFGTNCOGMA-SVCKFYHVSA-N |
| XLogP | 6.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.73 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|