methyl 5-(2-oxoimidazolidin-4-yl)pentanoate

C9H16N2O3 — CID 101336228

IUPACmethyl 5-(2-oxoimidazolidin-4-yl)pentanoate
SMILESCOC(=O)CCCCC1CNC(=O)N1
InChIInChI=1S/C9H16N2O3/c1-14-8(12)5-3-2-4-7-6-10-9(13)11-7/h7H,2-6H2,1H3,(H2,10,11,13)
InChIKeyDSRAABMMHDGNEN-UHFFFAOYSA-N
MW200.24 g/mol
LogP0.40
Rot. Bonds5

About methyl 5-(2-oxoimidazolidin-4-yl)pentanoate

methyl 5-(2-oxoimidazolidin-4-yl)pentanoate (PubChem CID 101336228) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is methyl 5-(2-oxoimidazolidin-4-yl)pentanoate.

Molecular Properties

Compound Namemethyl 5-(2-oxoimidazolidin-4-yl)pentanoate
PubChem CID101336228
Molecular FormulaC9H16N2O3
Molecular Weight200.24 g/mol
Exact Mass200.12
IUPAC Namemethyl 5-(2-oxoimidazolidin-4-yl)pentanoate
SMILESCOC(=O)CCCCC1CNC(=O)N1
InChIInChI=1S/C9H16N2O3/c1-14-8(12)5-3-2-4-7-6-10-9(13)11-7/h7H,2-6H2,1H3,(H2,10,11,13)
InChIKeyDSRAABMMHDGNEN-UHFFFAOYSA-N
XLogP0.40
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 50.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-(2-oxoimidazolidin-4-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(2-oxoimidazolidin-4-yl)pentanoate?
The IUPAC name of methyl 5-(2-oxoimidazolidin-4-yl)pentanoate (CID 101336228) is methyl 5-(2-oxoimidazolidin-4-yl)pentanoate.
What is the SMILES notation for methyl 5-(2-oxoimidazolidin-4-yl)pentanoate?
The canonical SMILES for methyl 5-(2-oxoimidazolidin-4-yl)pentanoate is COC(=O)CCCCC1CNC(=O)N1.
What is the InChIKey of methyl 5-(2-oxoimidazolidin-4-yl)pentanoate?
The InChIKey is DSRAABMMHDGNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-14-8(12)5-3-2-4-7-6-10-9(13)11-7/h7H,2-6H2,1H3,(H2,10,11,13).
What are the key properties of methyl 5-(2-oxoimidazolidin-4-yl)pentanoate?
methyl 5-(2-oxoimidazolidin-4-yl)pentanoate has a molecular weight of 200.24 g/mol, XLogP of 0.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2-oxoimidazolidin-4-yl)pentanoate is sourced from PubChem (CID 101336228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).