C18H39N9O3 — CID 59409014
4,9,14-tris[2-(methylamino)ethyl]-1,3,6,8,11,13-hexazacyclopentadecane-2,7,12-trione (PubChem CID 59409014) has the molecular formula C18H39N9O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 4,9,14-tris[2-(methylamino)ethyl]-1,3,6,8,11,13-hexazacyclopentadecane-2,7,12-trione.
| Compound Name | 4,9,14-tris[2-(methylamino)ethyl]-1,3,6,8,11,13-hexazacyclopentadecane-2,7,12-trione |
|---|---|
| PubChem CID | 59409014 |
| Molecular Formula | C18H39N9O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 4,9,14-tris[2-(methylamino)ethyl]-1,3,6,8,11,13-hexazacyclopentadecane-2,7,12-trione |
| SMILES | CNCCC1CNC(=O)NC(CCNC)CNC(=O)NC(CCNC)CNC(=O)N1 |
| InChI | InChI=1S/C18H39N9O3/c1-19-7-4-13-10-22-17(29)26-15(6-9-21-3)12-24-18(30)27-14(5-8-20-2)11-23-16(28)25-13/h13-15,19-21H,4-12H2,1-3H3,(H2,23,25,28)(H2,22,26,29)(H2,24,27,30) |
| InChIKey | VWCCJXZTEJVFLM-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |