C18H40N6O2 — CID 46867935
1-propyl-3-[3-[4-[3-(propylcarbamoylamino)propylamino]butylamino]propyl]urea (PubChem CID 46867935) has the molecular formula C18H40N6O2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-propyl-3-[3-[4-[3-(propylcarbamoylamino)propylamino]butylamino]propyl]urea.
| Compound Name | 1-propyl-3-[3-[4-[3-(propylcarbamoylamino)propylamino]butylamino]propyl]urea |
|---|---|
| PubChem CID | 46867935 |
| Molecular Formula | C18H40N6O2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | 1-propyl-3-[3-[4-[3-(propylcarbamoylamino)propylamino]butylamino]propyl]urea |
| SMILES | CCCNC(=O)NCCCNCCCCNCCCNC(=O)NCCC |
| InChI | InChI=1S/C18H40N6O2/c1-3-9-21-17(25)23-15-7-13-19-11-5-6-12-20-14-8-16-24-18(26)22-10-4-2/h19-20H,3-16H2,1-2H3,(H2,21,23,25)(H2,22,24,26) |
| InChIKey | KSDCSDKMJYPTRA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|