C10H16ClIO5 — CID 101336244
[(1R,2S)-3-chloro-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-iodo-2-methoxypropyl] formate (PubChem CID 101336244) has the molecular formula C10H16ClIO5 and a molecular weight of 378.59 g/mol. Its IUPAC name is [(1R,2S)-3-chloro-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-iodo-2-methoxypropyl] formate.
| Compound Name | [(1R,2S)-3-chloro-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-iodo-2-methoxypropyl] formate |
|---|---|
| PubChem CID | 101336244 |
| Molecular Formula | C10H16ClIO5 |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | [(1R,2S)-3-chloro-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-iodo-2-methoxypropyl] formate |
| SMILES | CO[C@H](C(Cl)I)[C@H](OC=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H16ClIO5/c1-10(2)16-4-6(17-10)7(15-5-13)8(14-3)9(11)12/h5-9H,4H2,1-3H3/t6-,7-,8+,9?/m1/s1 |
| InChIKey | YJKTWQPBIWGBFN-JSXQXQAOSA-N |
| XLogP | 1.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|