C25H33NO4Si — CID 101336946
(4S)-3-[(4R)-6-(furan-2-yl)-4-triethylsilyloxyhexa-1,2-dienyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 101336946) has the molecular formula C25H33NO4Si and a molecular weight of 439.63 g/mol. Its IUPAC name is (4S)-3-[(4R)-6-(furan-2-yl)-4-triethylsilyloxyhexa-1,2-dienyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(4R)-6-(furan-2-yl)-4-triethylsilyloxyhexa-1,2-dienyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101336946 |
| Molecular Formula | C25H33NO4Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (4S)-3-[(4R)-6-(furan-2-yl)-4-triethylsilyloxyhexa-1,2-dienyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C=C=CN1C(=O)OC[C@@H]1c1ccccc1)CCc1ccco1 |
| InChI | InChI=1S/C25H33NO4Si/c1-4-31(5-2,6-3)30-23(17-16-22-15-11-19-28-22)14-10-18-26-24(20-29-25(26)27)21-12-8-7-9-13-21/h7-9,11-15,18-19,23-24H,4-6,16-17,20H2,1-3H3/t10?,23-,24+/m0/s1 |
| InChIKey | WPWLVPCBLCKCOO-FMTYKBTPSA-N |
| XLogP | 6.46 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|