C16H30N2O2 — CID 101337532
(2S)-2-[(2-acetylcyclopentyl)amino]-N,N-diethyl-3-methylbutanamide (PubChem CID 101337532) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2S)-2-[(2-acetylcyclopentyl)amino]-N,N-diethyl-3-methylbutanamide.
| Compound Name | (2S)-2-[(2-acetylcyclopentyl)amino]-N,N-diethyl-3-methylbutanamide |
|---|---|
| PubChem CID | 101337532 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (2S)-2-[(2-acetylcyclopentyl)amino]-N,N-diethyl-3-methylbutanamide |
| SMILES | CCN(CC)C(=O)[C@@H](NC1CCCC1C(C)=O)C(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-6-18(7-2)16(20)15(11(3)4)17-14-10-8-9-13(14)12(5)19/h11,13-15,17H,6-10H2,1-5H3/t13?,14?,15-/m0/s1 |
| InChIKey | RTOGLTLSPVDIHH-NRXISQOPSA-N |
| XLogP | 2.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |