C21H27NO5 — CID 10133932
benzyl N-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-1-hydroxy-3-methylbutan-2-yl]carbamate (PubChem CID 10133932) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is benzyl N-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-1-hydroxy-3-methylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-1-hydroxy-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10133932 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | benzyl N-[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-1-hydroxy-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(O)=C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C21H27NO5/c1-13(2)18(22-20(26)27-12-14-8-6-5-7-9-14)19(25)17-15(23)10-21(3,4)11-16(17)24/h5-9,13,18,25H,10-12H2,1-4H3,(H,22,26) |
| InChIKey | BGURUIMLBOOZDE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|