C11H18O7 — CID 101342785
ethyl 2-[[(2R,3S,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]prop-2-enoate (PubChem CID 101342785) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(2R,3S,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 101342785 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | ethyl 2-[[(2R,3S,4S)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl]prop-2-enoate |
| SMILES | C=C(C[C@H]1OC(O)(CO)[C@@H](O)[C@@H]1O)C(=O)OCC |
| InChI | InChI=1S/C11H18O7/c1-3-17-10(15)6(2)4-7-8(13)9(14)11(16,5-12)18-7/h7-9,12-14,16H,2-5H2,1H3/t7-,8-,9+,11?/m1/s1 |
| InChIKey | XAUZCUVMVCCVKF-OEJXEDHQSA-N |
| XLogP | -1.70 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|