C6H11BaO9P — CID 133126663
barium(2+);[(2S,3R,4R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate (PubChem CID 133126663) has the molecular formula C6H11BaO9P and a molecular weight of 395.45 g/mol. Its IUPAC name is barium(2+);[(2S,3R,4R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate.
| Compound Name | barium(2+);[(2S,3R,4R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 133126663 |
| Molecular Formula | C6H11BaO9P |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.92 |
| IUPAC Name | barium(2+);[(2S,3R,4R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl phosphate |
| SMILES | O=P([O-])([O-])OC[C@@H]1OC(O)(CO)[C@H](O)[C@H]1O.[Ba+2] |
| InChI | InChI=1S/C6H13O9P.Ba/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13;/h3-5,7-10H,1-2H2,(H2,11,12,13);/q;+2/p-2/t3-,4-,5+,6?;/m0./s1 |
| InChIKey | JIBHRTXWOCOJFJ-KXZXHAEPSA-L |
| XLogP | -4.75 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|