C6H14O12P2 — CID 135053794
[(2R,3S,4R)-3,4,5-trihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 135053794) has the molecular formula C6H14O12P2 and a molecular weight of 340.11 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4,5-trihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-3,4,5-trihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135053794 |
| Molecular Formula | C6H14O12P2 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [(2R,3S,4R)-3,4,5-trihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1OC(O)(COP(=O)(O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-4-3(1-16-19(10,11)12)18-6(9,5(4)8)2-17-20(13,14)15/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4-,5-,6?/m1/s1 |
| InChIKey | RNBGYGVWRKECFJ-JDJSBBGDSA-N |
| XLogP | -2.99 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|