C10H15N2O10P — CID 163189866
[(2R,3S,4S,5R)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-2,3,4-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163189866) has the molecular formula C10H15N2O10P and a molecular weight of 354.21 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-2,3,4-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-2,3,4-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163189866 |
| Molecular Formula | C10H15N2O10P |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [(2R,3S,4S,5R)-5-[(2,4-dioxopyrimidin-1-yl)methyl]-2,3,4-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1ccn(C[C@H]2O[C@](O)(COP(=O)(O)O)[C@@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N2O10P/c13-6-1-2-12(9(16)11-6)3-5-7(14)8(15)10(17,22-5)4-21-23(18,19)20/h1-2,5,7-8,14-15,17H,3-4H2,(H,11,13,16)(H2,18,19,20)/t5-,7-,8+,10-/m1/s1 |
| InChIKey | LJGCKWPHBRQGPT-PJGXCUNHSA-N |
| XLogP | -3.54 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|