C37H54O4 — CID 101344015
[(3S,8R,9S,10R,13S,14S)-17-[(2R,3R,4R,5S)-3-hydroxy-5,6-dimethyl-4-phenylmethoxyheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 101344015) has the molecular formula C37H54O4 and a molecular weight of 562.84 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-[(2R,3R,4R,5S)-3-hydroxy-5,6-dimethyl-4-phenylmethoxyheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-[(2R,3R,4R,5S)-3-hydroxy-5,6-dimethyl-4-phenylmethoxyheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 101344015 |
| Molecular Formula | C37H54O4 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.40 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-[(2R,3R,4R,5S)-3-hydroxy-5,6-dimethyl-4-phenylmethoxyheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C([C@@H](C)[C@@H](O)[C@H](OCc4ccccc4)[C@@H](C)C(C)C)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C37H54O4/c1-23(2)24(3)35(40-22-27-11-9-8-10-12-27)34(39)25(4)31-15-16-32-30-14-13-28-21-29(41-26(5)38)17-19-36(28,6)33(30)18-20-37(31,32)7/h8-13,15,23-25,29-30,32-35,39H,14,16-22H2,1-7H3/t24-,25+,29-,30-,32-,33-,34+,35+,36-,37+/m0/s1 |
| InChIKey | SWDMASCOCPRLEN-UNAPMANRSA-N |
| XLogP | 8.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|