C12H18O2 — CID 101344795
[(1R,2S,4R)-2-ethoxy-2-bicyclo[2.2.1]hept-5-enyl]methylidene-ethyloxidanium (PubChem CID 101344795) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is [(1R,2S,4R)-2-ethoxy-2-bicyclo[2.2.1]hept-5-enyl]methylidene-ethyloxidanium.
| Compound Name | [(1R,2S,4R)-2-ethoxy-2-bicyclo[2.2.1]hept-5-enyl]methylidene-ethyloxidanium |
|---|---|
| PubChem CID | 101344795 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | [(1R,2S,4R)-2-ethoxy-2-bicyclo[2.2.1]hept-5-enyl]methylidene-ethyloxidanium |
| SMILES | CCO[C@@]1(/[C-]=[O+]/CC)C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H18O2/c1-3-13-9-12(14-4-2)8-10-5-6-11(12)7-10/h5-6,10-11H,3-4,7-8H2,1-2H3/t10-,11+,12-/m1/s1 |
| InChIKey | FXHAVYBFDGXJRQ-GRYCIOLGSA-N |
| XLogP | 2.02 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|