C13H16O4 — CID 58003186
(5R,8S)-2,4-bis(ethenyl)-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione (PubChem CID 58003186) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (5R,8S)-2,4-bis(ethenyl)-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione.
| Compound Name | (5R,8S)-2,4-bis(ethenyl)-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 58003186 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (5R,8S)-2,4-bis(ethenyl)-8-methyl-6,9-dioxaspiro[4.5]decane-7,10-dione |
| SMILES | C=CC1CC(C=C)[C@@]2(C1)OC(=O)[C@H](C)OC2=O |
| InChI | InChI=1S/C13H16O4/c1-4-9-6-10(5-2)13(7-9)12(15)16-8(3)11(14)17-13/h4-5,8-10H,1-2,6-7H2,3H3/t8-,9?,10?,13+/m0/s1 |
| InChIKey | BOCJGAAUBNKRGA-PPVZGCELSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|