C19H25NO3SSi — CID 101345374
[(2R,3S)-5-oxo-1-(2-phenylsulfanylethyl)-2-(2-trimethylsilylethynyl)pyrrolidin-3-yl] acetate (PubChem CID 101345374) has the molecular formula C19H25NO3SSi and a molecular weight of 375.57 g/mol. Its IUPAC name is [(2R,3S)-5-oxo-1-(2-phenylsulfanylethyl)-2-(2-trimethylsilylethynyl)pyrrolidin-3-yl] acetate.
| Compound Name | [(2R,3S)-5-oxo-1-(2-phenylsulfanylethyl)-2-(2-trimethylsilylethynyl)pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 101345374 |
| Molecular Formula | C19H25NO3SSi |
| Molecular Weight | 375.57 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(2R,3S)-5-oxo-1-(2-phenylsulfanylethyl)-2-(2-trimethylsilylethynyl)pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N(CCSc2ccccc2)[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H25NO3SSi/c1-15(21)23-18-14-19(22)20(17(18)10-13-25(2,3)4)11-12-24-16-8-6-5-7-9-16/h5-9,17-18H,11-12,14H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | SQJXZDGAAOKWLP-MSOLQXFVSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|