C16H21N3O5S — CID 101345849
ethyl 5-[4-(benzenesulfonyloxymethyl)triazol-1-yl]pentanoate (PubChem CID 101345849) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is ethyl 5-[4-(benzenesulfonyloxymethyl)triazol-1-yl]pentanoate.
| Compound Name | ethyl 5-[4-(benzenesulfonyloxymethyl)triazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 101345849 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 5-[4-(benzenesulfonyloxymethyl)triazol-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCCn1cc(COS(=O)(=O)c2ccccc2)nn1 |
| InChI | InChI=1S/C16H21N3O5S/c1-2-23-16(20)10-6-7-11-19-12-14(17-18-19)13-24-25(21,22)15-8-4-3-5-9-15/h3-5,8-9,12H,2,6-7,10-11,13H2,1H3 |
| InChIKey | OTVJOZVZIPTSHL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|