C17H19F3N4OS — CID 10134612
(Z)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4,4,4-trifluoro-3-methylbut-2-en-1-one (PubChem CID 10134612) has the molecular formula C17H19F3N4OS and a molecular weight of 384.43 g/mol. Its IUPAC name is (Z)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4,4,4-trifluoro-3-methylbut-2-en-1-one.
| Compound Name | (Z)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4,4,4-trifluoro-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 10134612 |
| Molecular Formula | C17H19F3N4OS |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (Z)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-4,4,4-trifluoro-3-methylbut-2-en-1-one |
| SMILES | CCc1cc2c(N3CCN(C(=O)/C=C(/C)C(F)(F)F)CC3)ncnc2s1 |
| InChI | InChI=1S/C17H19F3N4OS/c1-3-12-9-13-15(21-10-22-16(13)26-12)24-6-4-23(5-7-24)14(25)8-11(2)17(18,19)20/h8-10H,3-7H2,1-2H3/b11-8- |
| InChIKey | MKZKDPVOJDPJNV-FLIBITNWSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|